C21H23ClN4O3S2 — CID 17300556
N-(4-chloro-2,5-dimethoxyphenyl)-2-[[4-methyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17300556) has the molecular formula C21H23ClN4O3S2 and a molecular weight of 479.03 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-[[4-methyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[[4-methyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17300556 |
| Molecular Formula | C21H23ClN4O3S2 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[[4-methyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1cc(NC(=O)CSc2nnc(-c3csc4c3CCCC4)n2C)c(OC)cc1Cl |
| InChI | InChI=1S/C21H23ClN4O3S2/c1-26-20(13-10-30-18-7-5-4-6-12(13)18)24-25-21(26)31-11-19(27)23-15-9-16(28-2)14(22)8-17(15)29-3/h8-10H,4-7,11H2,1-3H3,(H,23,27) |
| InChIKey | CLEYAYVTSCRFAI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |