C21H19Cl3N4OS2 — CID 19722340
2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 19722340) has the molecular formula C21H19Cl3N4OS2 and a molecular weight of 513.90 g/mol. Its IUPAC name is 2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19722340 |
| Molecular Formula | C21H19Cl3N4OS2 |
| Molecular Weight | 513.90 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | 2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1-c1csc2c1CCCC2 |
| InChI | InChI=1S/C21H19Cl3N4OS2/c1-2-7-28-20(13-10-30-18-6-4-3-5-12(13)18)26-27-21(28)31-11-19(29)25-17-9-15(23)14(22)8-16(17)24/h2,8-10H,1,3-7,11H2,(H,25,29) |
| InChIKey | REJJJTWRTQBXJA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.90 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|