C22H23ClN4OS2 — CID 17267541
N-(5-chloro-2-methylphenyl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17267541) has the molecular formula C22H23ClN4OS2 and a molecular weight of 459.04 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17267541 |
| Molecular Formula | C22H23ClN4OS2 |
| Molecular Weight | 459.04 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)ccc2C)nnc1-c1csc2c1CCCC2 |
| InChI | InChI=1S/C22H23ClN4OS2/c1-3-10-27-21(17-12-29-19-7-5-4-6-16(17)19)25-26-22(27)30-13-20(28)24-18-11-15(23)9-8-14(18)2/h3,8-9,11-12H,1,4-7,10,13H2,2H3,(H,24,28) |
| InChIKey | MLJZXLONKIJUMB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.04 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|