C21H21N5O3S2 — CID 19722311
N-(2-nitrophenyl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19722311) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is N-(2-nitrophenyl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-nitrophenyl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19722311 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-(2-nitrophenyl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2[N+](=O)[O-])nnc1-c1csc2c1CCCC2 |
| InChI | InChI=1S/C21H21N5O3S2/c1-2-11-25-20(15-12-30-18-10-6-3-7-14(15)18)23-24-21(25)31-13-19(27)22-16-8-4-5-9-17(16)26(28)29/h2,4-5,8-9,12H,1,3,6-7,10-11,13H2,(H,22,27) |
| InChIKey | OVKSZSYTPCIFEY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|