About 1-butylaziridine;triethoxysilane
1-butylaziridine;triethoxysilane (PubChem CID 173013888) has the molecular formula C12H29NO3Si
and a molecular weight of 263.45 g/mol. Its IUPAC name is 1-butylaziridine;triethoxysilane.
Molecular Properties
| Compound Name | 1-butylaziridine;triethoxysilane |
| PubChem CID | 173013888 |
| Molecular Formula | C12H29NO3Si |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-butylaziridine;triethoxysilane |
| SMILES | CCCCN1CC1.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C6H13N.C6H16O3Si/c1-2-3-4-7-5-6-7;1-4-7-10(8-5-2)9-6-3/h2-6H2,1H3;10H,4-6H2,1-3H3 |
| InChIKey | WBEJVPMISUDGQW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-butylaziridine;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylaziridine;triethoxysilane?
The IUPAC name of 1-butylaziridine;triethoxysilane (CID 173013888) is 1-butylaziridine;triethoxysilane.
What is the SMILES notation for 1-butylaziridine;triethoxysilane?
The canonical SMILES for 1-butylaziridine;triethoxysilane is CCCCN1CC1.CCO[SiH](OCC)OCC.
What is the InChIKey of 1-butylaziridine;triethoxysilane?
The InChIKey is WBEJVPMISUDGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C6H16O3Si/c1-2-3-4-7-5-6-7;1-4-7-10(8-5-2)9-6-3/h2-6H2,1H3;10H,4-6H2,1-3H3.
What are the key properties of 1-butylaziridine;triethoxysilane?
1-butylaziridine;triethoxysilane has a molecular weight of 263.45 g/mol, XLogP of 1.92, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylaziridine;triethoxysilane is sourced from PubChem (CID 173013888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).