About chromium;hydroxy-octadec-9-enoyl-oxophosphanium
chromium;hydroxy-octadec-9-enoyl-oxophosphanium (PubChem CID 173015672) has the molecular formula C18H34CrO3P+
and a molecular weight of 381.44 g/mol. Its IUPAC name is chromium;hydroxy-octadec-9-enoyl-oxophosphanium.
Molecular Properties
| Compound Name | chromium;hydroxy-octadec-9-enoyl-oxophosphanium |
| PubChem CID | 173015672 |
| Molecular Formula | C18H34CrO3P+ |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | chromium;hydroxy-octadec-9-enoyl-oxophosphanium |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)[P+](=O)O.[Cr] |
| InChI | InChI=1S/C18H33O3P.Cr/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)22(20)21;/h9-10H,2-8,11-17H2,1H3;/p+1 |
| InChIKey | GVSHDYKSPRIURB-UHFFFAOYSA-O |
| XLogP | 6.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chromium;hydroxy-octadec-9-enoyl-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;hydroxy-octadec-9-enoyl-oxophosphanium?
The IUPAC name of chromium;hydroxy-octadec-9-enoyl-oxophosphanium (CID 173015672) is chromium;hydroxy-octadec-9-enoyl-oxophosphanium.
What is the SMILES notation for chromium;hydroxy-octadec-9-enoyl-oxophosphanium?
The canonical SMILES for chromium;hydroxy-octadec-9-enoyl-oxophosphanium is CCCCCCCCC=CCCCCCCCC(=O)[P+](=O)O.[Cr].
What is the InChIKey of chromium;hydroxy-octadec-9-enoyl-oxophosphanium?
The InChIKey is GVSHDYKSPRIURB-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H33O3P.Cr/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)22(20)21;/h9-10H,2-8,11-17H2,1H3;/p+1.
What are the key properties of chromium;hydroxy-octadec-9-enoyl-oxophosphanium?
chromium;hydroxy-octadec-9-enoyl-oxophosphanium has a molecular weight of 381.44 g/mol, XLogP of 6.28, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;hydroxy-octadec-9-enoyl-oxophosphanium is sourced from PubChem (CID 173015672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).