C15H23N5O6S — CID 173016004
2-imino-1-methylimidazolidin-4-one;2-(5-methoxy-1H-indol-3-yl)ethanamine;sulfuric acid (PubChem CID 173016004) has the molecular formula C15H23N5O6S and a molecular weight of 401.45 g/mol. Its IUPAC name is 2-imino-1-methylimidazolidin-4-one;2-(5-methoxy-1H-indol-3-yl)ethanamine;sulfuric acid.
| Compound Name | 2-imino-1-methylimidazolidin-4-one;2-(5-methoxy-1H-indol-3-yl)ethanamine;sulfuric acid |
|---|---|
| PubChem CID | 173016004 |
| Molecular Formula | C15H23N5O6S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-imino-1-methylimidazolidin-4-one;2-(5-methoxy-1H-indol-3-yl)ethanamine;sulfuric acid |
| SMILES | COc1ccc2[nH]cc(CCN)c2c1.O=S(=O)(O)O.[H]/N=C1/NC(=O)CN1C |
| InChI | InChI=1S/C11H14N2O.C4H7N3O.H2O4S/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11;1-7-2-3(8)6-4(7)5;1-5(2,3)4/h2-3,6-7,13H,4-5,12H2,1H3;2H2,1H3,(H2,5,6,8);(H2,1,2,3,4) |
| InChIKey | NBPVWCHAMSYGRS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 181.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|