C26H58O4Si2 — CID 173016868
2,4-bis[(2-methylpropan-2-yl)oxy]butyl-[2-[2,4-bis[(2-methylpropan-2-yl)oxy]butylsilyl]ethyl]silane (PubChem CID 173016868) has the molecular formula C26H58O4Si2 and a molecular weight of 490.92 g/mol. Its IUPAC name is 2,4-bis[(2-methylpropan-2-yl)oxy]butyl-[2-[2,4-bis[(2-methylpropan-2-yl)oxy]butylsilyl]ethyl]silane.
| Compound Name | 2,4-bis[(2-methylpropan-2-yl)oxy]butyl-[2-[2,4-bis[(2-methylpropan-2-yl)oxy]butylsilyl]ethyl]silane |
|---|---|
| PubChem CID | 173016868 |
| Molecular Formula | C26H58O4Si2 |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.39 |
| IUPAC Name | 2,4-bis[(2-methylpropan-2-yl)oxy]butyl-[2-[2,4-bis[(2-methylpropan-2-yl)oxy]butylsilyl]ethyl]silane |
| SMILES | CC(C)(C)OCCC(C[SiH2]CC[SiH2]CC(CCOC(C)(C)C)OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C26H58O4Si2/c1-23(2,3)27-15-13-21(29-25(7,8)9)19-31-17-18-32-20-22(30-26(10,11)12)14-16-28-24(4,5)6/h21-22H,13-20,31-32H2,1-12H3 |
| InChIKey | CMZAISKUXMNDLS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|