C24H54O4Si2 — CID 123812229
3,3-bis[(2-methylpropan-2-yl)oxy]propyl-[2-[3,3-bis[(2-methylpropan-2-yl)oxy]propylsilyl]ethyl]silane (PubChem CID 123812229) has the molecular formula C24H54O4Si2 and a molecular weight of 462.86 g/mol. Its IUPAC name is 3,3-bis[(2-methylpropan-2-yl)oxy]propyl-[2-[3,3-bis[(2-methylpropan-2-yl)oxy]propylsilyl]ethyl]silane.
| Compound Name | 3,3-bis[(2-methylpropan-2-yl)oxy]propyl-[2-[3,3-bis[(2-methylpropan-2-yl)oxy]propylsilyl]ethyl]silane |
|---|---|
| PubChem CID | 123812229 |
| Molecular Formula | C24H54O4Si2 |
| Molecular Weight | 462.86 g/mol |
| Exact Mass | 462.36 |
| IUPAC Name | 3,3-bis[(2-methylpropan-2-yl)oxy]propyl-[2-[3,3-bis[(2-methylpropan-2-yl)oxy]propylsilyl]ethyl]silane |
| SMILES | CC(C)(C)OC(CC[SiH2]CC[SiH2]CCC(OC(C)(C)C)OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C24H54O4Si2/c1-21(2,3)25-19(26-22(4,5)6)13-15-29-17-18-30-16-14-20(27-23(7,8)9)28-24(10,11)12/h19-20H,13-18,29-30H2,1-12H3 |
| InChIKey | XXFKKLPBONZOBF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.86 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|