C7H5ClN3O2- — CID 173017284
6-chloro-1-oxido-2,4-dihydro-1,2,4-benzotriazin-3-one (PubChem CID 173017284) has the molecular formula C7H5ClN3O2- and a molecular weight of 198.59 g/mol. Its IUPAC name is 6-chloro-1-oxido-2,4-dihydro-1,2,4-benzotriazin-3-one.
| Compound Name | 6-chloro-1-oxido-2,4-dihydro-1,2,4-benzotriazin-3-one |
|---|---|
| PubChem CID | 173017284 |
| Molecular Formula | C7H5ClN3O2- |
| Molecular Weight | 198.59 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 6-chloro-1-oxido-2,4-dihydro-1,2,4-benzotriazin-3-one |
| SMILES | O=C1Nc2cc(Cl)ccc2N([O-])N1 |
| InChI | InChI=1S/C7H5ClN3O2/c8-4-1-2-6-5(3-4)9-7(12)10-11(6)13/h1-3H,(H2,9,10,12)/q-1 |
| InChIKey | ALRRBVZAGDLFKY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.59 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |