About butanedioic acid;prop-2-ene-1-thiol
butanedioic acid;prop-2-ene-1-thiol (PubChem CID 173017966) has the molecular formula C7H12O4S
and a molecular weight of 192.24 g/mol. Its IUPAC name is butanedioic acid;prop-2-ene-1-thiol.
Molecular Properties
| Compound Name | butanedioic acid;prop-2-ene-1-thiol |
| PubChem CID | 173017966 |
| Molecular Formula | C7H12O4S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | butanedioic acid;prop-2-ene-1-thiol |
| SMILES | C=CCS.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C4H6O4.C3H6S/c5-3(6)1-2-4(7)8;1-2-3-4/h1-2H2,(H,5,6)(H,7,8);2,4H,1,3H2 |
| InChIKey | YSDMIJDZTCJYAK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;prop-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;prop-2-ene-1-thiol?
The IUPAC name of butanedioic acid;prop-2-ene-1-thiol (CID 173017966) is butanedioic acid;prop-2-ene-1-thiol.
What is the SMILES notation for butanedioic acid;prop-2-ene-1-thiol?
The canonical SMILES for butanedioic acid;prop-2-ene-1-thiol is C=CCS.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;prop-2-ene-1-thiol?
The InChIKey is YSDMIJDZTCJYAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4.C3H6S/c5-3(6)1-2-4(7)8;1-2-3-4/h1-2H2,(H,5,6)(H,7,8);2,4H,1,3H2.
What are the key properties of butanedioic acid;prop-2-ene-1-thiol?
butanedioic acid;prop-2-ene-1-thiol has a molecular weight of 192.24 g/mol, XLogP of 1.04, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;prop-2-ene-1-thiol is sourced from PubChem (CID 173017966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).