C18H30NO5S2+ — CID 173018125
dimethyl-[4-(2-methyl-2-piperidin-1-ylpropanoyl)phenyl]sulfanium;methyl hydrogen sulfate (PubChem CID 173018125) has the molecular formula C18H30NO5S2+ and a molecular weight of 404.57 g/mol. Its IUPAC name is dimethyl-[4-(2-methyl-2-piperidin-1-ylpropanoyl)phenyl]sulfanium;methyl hydrogen sulfate.
| Compound Name | dimethyl-[4-(2-methyl-2-piperidin-1-ylpropanoyl)phenyl]sulfanium;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 173018125 |
| Molecular Formula | C18H30NO5S2+ |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | dimethyl-[4-(2-methyl-2-piperidin-1-ylpropanoyl)phenyl]sulfanium;methyl hydrogen sulfate |
| SMILES | COS(=O)(=O)O.C[S+](C)c1ccc(C(=O)C(C)(C)N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H26NOS.CH4O4S/c1-17(2,18-12-6-5-7-13-18)16(19)14-8-10-15(11-9-14)20(3)4;1-5-6(2,3)4/h8-11H,5-7,12-13H2,1-4H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | UWCLGOFLZFYNDT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|