C19H25IN4O3 — CID 173018852
tert-butyl (5R,7S)-4-imino-1-(4-iodophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 173018852) has the molecular formula C19H25IN4O3 and a molecular weight of 484.34 g/mol. Its IUPAC name is tert-butyl (5R,7S)-4-imino-1-(4-iodophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl (5R,7S)-4-imino-1-(4-iodophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 173018852 |
| Molecular Formula | C19H25IN4O3 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | tert-butyl (5R,7S)-4-imino-1-(4-iodophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | [H]/N=C1\NC(=O)N(c2ccc(I)cc2)[C@@]12CCN(C(=O)OC(C)(C)C)[C@@H](C)C2 |
| InChI | InChI=1S/C19H25IN4O3/c1-12-11-19(9-10-23(12)17(26)27-18(2,3)4)15(21)22-16(25)24(19)14-7-5-13(20)6-8-14/h5-8,12H,9-11H2,1-4H3,(H2,21,22,25)/t12-,19+/m0/s1 |
| InChIKey | YAXVBPFOCFZWGR-HXPMCKFVSA-N |
| XLogP | 3.96 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|