C21H30N4O3 — CID 140898920
tert-butyl 4-imino-2-oxo-1-(3,4,5-trimethylphenyl)-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 140898920) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is tert-butyl 4-imino-2-oxo-1-(3,4,5-trimethylphenyl)-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 4-imino-2-oxo-1-(3,4,5-trimethylphenyl)-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 140898920 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | tert-butyl 4-imino-2-oxo-1-(3,4,5-trimethylphenyl)-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | [H]/N=C1\NC(=O)N(c2cc(C)c(C)c(C)c2)C12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C21H30N4O3/c1-13-11-16(12-14(2)15(13)3)25-18(26)23-17(22)21(25)7-9-24(10-8-21)19(27)28-20(4,5)6/h11-12H,7-10H2,1-6H3,(H2,22,23,26) |
| InChIKey | VWJDEPBNIAZQJG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|