C11H27NO4Si — CID 173020312
1-diethoxysilyl-N,N-diethoxypropan-1-amine (PubChem CID 173020312) has the molecular formula C11H27NO4Si and a molecular weight of 265.43 g/mol. Its IUPAC name is 1-diethoxysilyl-N,N-diethoxypropan-1-amine.
| Compound Name | 1-diethoxysilyl-N,N-diethoxypropan-1-amine |
|---|---|
| PubChem CID | 173020312 |
| Molecular Formula | C11H27NO4Si |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-diethoxysilyl-N,N-diethoxypropan-1-amine |
| SMILES | CCON(OCC)C(CC)[SiH](OCC)OCC |
| InChI | InChI=1S/C11H27NO4Si/c1-6-11(12(13-7-2)14-8-3)17(15-9-4)16-10-5/h11,17H,6-10H2,1-5H3 |
| InChIKey | CZWNYJPOCPHZIP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|