C21H24 — CID 173021193
2-(5-butylcyclopenta-1,4-dien-1-yl)-1-prop-2-enyl-1H-indene (PubChem CID 173021193) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(5-butylcyclopenta-1,4-dien-1-yl)-1-prop-2-enyl-1H-indene.
| Compound Name | 2-(5-butylcyclopenta-1,4-dien-1-yl)-1-prop-2-enyl-1H-indene |
|---|---|
| PubChem CID | 173021193 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-(5-butylcyclopenta-1,4-dien-1-yl)-1-prop-2-enyl-1H-indene |
| SMILES | C=CCC1C(C2=CCC=C2CCCC)=Cc2ccccc21 |
| InChI | InChI=1S/C21H24/c1-3-5-10-16-12-8-14-18(16)21-15-17-11-6-7-13-19(17)20(21)9-4-2/h4,6-7,11-15,20H,2-3,5,8-10H2,1H3 |
| InChIKey | KSHWWTBPHQYRBO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|