C15H32N2OSi — CID 173022899
1,1-dicyclohexyl-2-ethyl-2-methoxysilylhydrazine (PubChem CID 173022899) has the molecular formula C15H32N2OSi and a molecular weight of 284.52 g/mol. Its IUPAC name is 1,1-dicyclohexyl-2-ethyl-2-methoxysilylhydrazine.
| Compound Name | 1,1-dicyclohexyl-2-ethyl-2-methoxysilylhydrazine |
|---|---|
| PubChem CID | 173022899 |
| Molecular Formula | C15H32N2OSi |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 1,1-dicyclohexyl-2-ethyl-2-methoxysilylhydrazine |
| SMILES | CCN([SiH2]OC)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H32N2OSi/c1-3-16(19-18-2)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h14-15H,3-13,19H2,1-2H3 |
| InChIKey | XOMZQUCYTINGAP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|