C18H36N2 — CID 57240749
1,1-dicyclohexyl-2,2-di(propan-2-yl)hydrazine (PubChem CID 57240749) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 1,1-dicyclohexyl-2,2-di(propan-2-yl)hydrazine.
| Compound Name | 1,1-dicyclohexyl-2,2-di(propan-2-yl)hydrazine |
|---|---|
| PubChem CID | 57240749 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 1,1-dicyclohexyl-2,2-di(propan-2-yl)hydrazine |
| SMILES | CC(C)N(C(C)C)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H36N2/c1-15(2)19(16(3)4)20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h15-18H,5-14H2,1-4H3 |
| InChIKey | OFTAJGLOWYQABZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|