C3H7N13 — CID 173025906
bis(2H-tetrazol-5-yl)diazene;guanidine (PubChem CID 173025906) has the molecular formula C3H7N13 and a molecular weight of 225.18 g/mol. Its IUPAC name is bis(2H-tetrazol-5-yl)diazene;guanidine.
| Compound Name | bis(2H-tetrazol-5-yl)diazene;guanidine |
|---|---|
| PubChem CID | 173025906 |
| Molecular Formula | C3H7N13 |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | bis(2H-tetrazol-5-yl)diazene;guanidine |
| SMILES | N(=Nc1nn[nH]n1)c1nn[nH]n1.[H]N=C(N)N |
| InChI | InChI=1S/C2H2N10.CH5N3/c3(1-5-9-10-6-1)4-2-7-11-12-8-2;2-1(3)4/h(H,5,6,9,10)(H,7,8,11,12);(H5,2,3,4) |
| InChIKey | KSQFRMPOEJCKIY-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 209.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|