C9H10N6O — CID 170922069
(4-methoxyphenyl)methyl-(2H-tetrazol-5-yl)diazene (PubChem CID 170922069) has the molecular formula C9H10N6O and a molecular weight of 218.22 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl-(2H-tetrazol-5-yl)diazene.
| Compound Name | (4-methoxyphenyl)methyl-(2H-tetrazol-5-yl)diazene |
|---|---|
| PubChem CID | 170922069 |
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (4-methoxyphenyl)methyl-(2H-tetrazol-5-yl)diazene |
| SMILES | COc1ccc(C/N=N/c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C9H10N6O/c1-16-8-4-2-7(3-5-8)6-10-11-9-12-14-15-13-9/h2-5H,6H2,1H3,(H,12,13,14,15)/b11-10+ |
| InChIKey | LDKCRZSWTDGPIH-ZHACJKMWSA-N |
| XLogP | 1.49 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|