C10H7N11 — CID 135820736
1-N,3-N-bis(2H-tetrazol-5-yl)isoindole-1,3-diimine (PubChem CID 135820736) has the molecular formula C10H7N11 and a molecular weight of 281.24 g/mol. Its IUPAC name is 1-N,3-N-bis(2H-tetrazol-5-yl)isoindole-1,3-diimine.
| Compound Name | 1-N,3-N-bis(2H-tetrazol-5-yl)isoindole-1,3-diimine |
|---|---|
| PubChem CID | 135820736 |
| Molecular Formula | C10H7N11 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-N,3-N-bis(2H-tetrazol-5-yl)isoindole-1,3-diimine |
| SMILES | c1ccc2c(c1)C(=Nc1nn[nH]n1)N/C2=N\c1nn[nH]n1 |
| InChI | InChI=1S/C10H7N11/c1-2-4-6-5(3-1)7(12-9-14-18-19-15-9)11-8(6)13-10-16-20-21-17-10/h1-4H,(H3,11,12,13,14,15,16,17,18,19,20,21) |
| InChIKey | FHRKCFFGACAKMI-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 145.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|