C10H5N5O2 — CID 5338641
2-(2H-tetrazol-5-ylimino)indene-1,3-dione (PubChem CID 5338641) has the molecular formula C10H5N5O2 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-(2H-tetrazol-5-ylimino)indene-1,3-dione.
| Compound Name | 2-(2H-tetrazol-5-ylimino)indene-1,3-dione |
|---|---|
| PubChem CID | 5338641 |
| Molecular Formula | C10H5N5O2 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-(2H-tetrazol-5-ylimino)indene-1,3-dione |
| SMILES | O=c1c(=Nc2nn[nH]n2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C10H5N5O2/c16-8-5-3-1-2-4-6(5)9(17)7(8)11-10-12-14-15-13-10/h1-4H,(H,12,13,14,15) |
| InChIKey | JVBYPNOALSKFQZ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |