C11H23N3O4S — CID 173027773
3-(1-butylimidazol-2-yl)propan-1-amine;methyl hydrogen sulfate (PubChem CID 173027773) has the molecular formula C11H23N3O4S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-(1-butylimidazol-2-yl)propan-1-amine;methyl hydrogen sulfate.
| Compound Name | 3-(1-butylimidazol-2-yl)propan-1-amine;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 173027773 |
| Molecular Formula | C11H23N3O4S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-(1-butylimidazol-2-yl)propan-1-amine;methyl hydrogen sulfate |
| SMILES | CCCCn1ccnc1CCCN.COS(=O)(=O)O |
| InChI | InChI=1S/C10H19N3.CH4O4S/c1-2-3-8-13-9-7-12-10(13)5-4-6-11;1-5-6(2,3)4/h7,9H,2-6,8,11H2,1H3;1H3,(H,2,3,4) |
| InChIKey | OYBAHHVHDGCLHW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|