About 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum
1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum (PubChem CID 174536207) has the molecular formula C10H18N2PtS
and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum.
Molecular Properties
| Compound Name | 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum |
| PubChem CID | 174536207 |
| Molecular Formula | C10H18N2PtS |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum |
| SMILES | CCCCn1ccnc1CCSC.[Pt] |
| InChI | InChI=1S/C10H18N2S.Pt/c1-3-4-7-12-8-6-11-10(12)5-9-13-2;/h6,8H,3-5,7,9H2,1-2H3; |
| InChIKey | ACYWEDSSGPDAAJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum?
The IUPAC name of 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum (CID 174536207) is 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum.
What is the SMILES notation for 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum?
The canonical SMILES for 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum is CCCCn1ccnc1CCSC.[Pt].
What is the InChIKey of 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum?
The InChIKey is ACYWEDSSGPDAAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S.Pt/c1-3-4-7-12-8-6-11-10(12)5-9-13-2;/h6,8H,3-5,7,9H2,1-2H3;.
What are the key properties of 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum?
1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum has a molecular weight of 393.41 g/mol, XLogP of 2.59, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-(2-methylsulfanylethyl)imidazole;platinum is sourced from PubChem (CID 174536207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).