C17H14Br2O3 — CID 173032917
2,3-dibromo-1-(3-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 173032917) has the molecular formula C17H14Br2O3 and a molecular weight of 426.10 g/mol. Its IUPAC name is 2,3-dibromo-1-(3-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 2,3-dibromo-1-(3-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 173032917 |
| Molecular Formula | C17H14Br2O3 |
| Molecular Weight | 426.10 g/mol |
| Exact Mass | 423.93 |
| IUPAC Name | 2,3-dibromo-1-(3-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(Br)=C(Br)C(=O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C17H14Br2O3/c1-21-13-8-6-11(7-9-13)15(18)16(19)17(20)12-4-3-5-14(10-12)22-2/h3-10H,1-2H3 |
| InChIKey | HZNPOEBFJYCECJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.10 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|