C15H11Br3O — CID 15366242
1-bromo-4-[(E)-1,2-dibromo-2-(3-methoxyphenyl)ethenyl]benzene (PubChem CID 15366242) has the molecular formula C15H11Br3O and a molecular weight of 446.96 g/mol. Its IUPAC name is 1-bromo-4-[(E)-1,2-dibromo-2-(3-methoxyphenyl)ethenyl]benzene.
| Compound Name | 1-bromo-4-[(E)-1,2-dibromo-2-(3-methoxyphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 15366242 |
| Molecular Formula | C15H11Br3O |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 443.84 |
| IUPAC Name | 1-bromo-4-[(E)-1,2-dibromo-2-(3-methoxyphenyl)ethenyl]benzene |
| SMILES | COc1cccc(/C(Br)=C(\Br)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C15H11Br3O/c1-19-13-4-2-3-11(9-13)15(18)14(17)10-5-7-12(16)8-6-10/h2-9H,1H3/b15-14+ |
| InChIKey | OVHWWRCAGMHVRG-CCEZHUSRSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|