About magnesium;hydride;1-iodo-2,4-dimethylbenzene
magnesium;hydride;1-iodo-2,4-dimethylbenzene (PubChem CID 173036692) has the molecular formula C8H11IMg
and a molecular weight of 258.38 g/mol. Its IUPAC name is magnesium;hydride;1-iodo-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | magnesium;hydride;1-iodo-2,4-dimethylbenzene |
| PubChem CID | 173036692 |
| Molecular Formula | C8H11IMg |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | magnesium;hydride;1-iodo-2,4-dimethylbenzene |
| SMILES | Cc1ccc(I)c(C)c1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C8H9I.Mg.2H/c1-6-3-4-8(9)7(2)5-6;;;/h3-5H,1-2H3;;;/q;+2;2*-1 |
| InChIKey | HCPDBTPAPZHEFD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydride;1-iodo-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;1-iodo-2,4-dimethylbenzene?
The IUPAC name of magnesium;hydride;1-iodo-2,4-dimethylbenzene (CID 173036692) is magnesium;hydride;1-iodo-2,4-dimethylbenzene.
What is the SMILES notation for magnesium;hydride;1-iodo-2,4-dimethylbenzene?
The canonical SMILES for magnesium;hydride;1-iodo-2,4-dimethylbenzene is Cc1ccc(I)c(C)c1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;1-iodo-2,4-dimethylbenzene?
The InChIKey is HCPDBTPAPZHEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9I.Mg.2H/c1-6-3-4-8(9)7(2)5-6;;;/h3-5H,1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;hydride;1-iodo-2,4-dimethylbenzene?
magnesium;hydride;1-iodo-2,4-dimethylbenzene has a molecular weight of 258.38 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;1-iodo-2,4-dimethylbenzene is sourced from PubChem (CID 173036692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).