C22H30 — CID 173037204
5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;hex-1-enylbenzene (PubChem CID 173037204) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;hex-1-enylbenzene.
| Compound Name | 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;hex-1-enylbenzene |
|---|---|
| PubChem CID | 173037204 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;hex-1-enylbenzene |
| SMILES | C=CC1(C)C=CC=C(C)C1.CCCCC=Cc1ccccc1 |
| InChI | InChI=1S/C12H16.C10H14/c1-2-3-4-6-9-12-10-7-5-8-11-12;1-4-10(3)7-5-6-9(2)8-10/h5-11H,2-4H2,1H3;4-7H,1,8H2,2-3H3 |
| InChIKey | PFSCVFQORPTYBX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|