C24H48O10 — CID 173041629
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;1,2,3-triethoxy-1-(1,2,3-triethoxyprop-1-enoxy)prop-1-ene (PubChem CID 173041629) has the molecular formula C24H48O10 and a molecular weight of 496.64 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;1,2,3-triethoxy-1-(1,2,3-triethoxyprop-1-enoxy)prop-1-ene.
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;1,2,3-triethoxy-1-(1,2,3-triethoxyprop-1-enoxy)prop-1-ene |
|---|---|
| PubChem CID | 173041629 |
| Molecular Formula | C24H48O10 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;1,2,3-triethoxy-1-(1,2,3-triethoxyprop-1-enoxy)prop-1-ene |
| SMILES | CCC(CO)(CO)CO.CCOCC(OCC)=C(OCC)OC(OCC)=C(COCC)OCC |
| InChI | InChI=1S/C18H34O7.C6H14O3/c1-7-19-13-15(21-9-3)17(23-11-5)25-18(24-12-6)16(22-10-4)14-20-8-2;1-2-6(3-7,4-8)5-9/h7-14H2,1-6H3;7-9H,2-5H2,1H3 |
| InChIKey | ZPKYHCUPFMTKHI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|