C9H15ClO2S — CID 173041848
2-chloro-1-ethenylsulfonyl-4,4-dimethylpent-2-ene (PubChem CID 173041848) has the molecular formula C9H15ClO2S and a molecular weight of 222.74 g/mol. Its IUPAC name is 2-chloro-1-ethenylsulfonyl-4,4-dimethylpent-2-ene.
| Compound Name | 2-chloro-1-ethenylsulfonyl-4,4-dimethylpent-2-ene |
|---|---|
| PubChem CID | 173041848 |
| Molecular Formula | C9H15ClO2S |
| Molecular Weight | 222.74 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-chloro-1-ethenylsulfonyl-4,4-dimethylpent-2-ene |
| SMILES | C=CS(=O)(=O)CC(Cl)=CC(C)(C)C |
| InChI | InChI=1S/C9H15ClO2S/c1-5-13(11,12)7-8(10)6-9(2,3)4/h5-6H,1,7H2,2-4H3 |
| InChIKey | GAOIODIGUFHRAF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.74 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |