C9H14N2O6S2 — CID 118968619
2-ethenylsulfonyl-N-[2-(ethenylsulfonylcarbonylamino)ethyl]acetamide (PubChem CID 118968619) has the molecular formula C9H14N2O6S2 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-ethenylsulfonyl-N-[2-(ethenylsulfonylcarbonylamino)ethyl]acetamide.
| Compound Name | 2-ethenylsulfonyl-N-[2-(ethenylsulfonylcarbonylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 118968619 |
| Molecular Formula | C9H14N2O6S2 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 2-ethenylsulfonyl-N-[2-(ethenylsulfonylcarbonylamino)ethyl]acetamide |
| SMILES | C=CS(=O)(=O)CC(=O)NCCNC(=O)S(=O)(=O)C=C |
| InChI | InChI=1S/C9H14N2O6S2/c1-3-18(14,15)7-8(12)10-5-6-11-9(13)19(16,17)4-2/h3-4H,1-2,5-7H2,(H,10,12)(H,11,13) |
| InChIKey | POUQAZZCIOJYBR-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|