C27H29ClF4N5O4+ — CID 173042337
[5-[5-(5-chloro-2-fluorobenzoyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-(2,2-dimethylpropyl)-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 173042337) has the molecular formula C27H29ClF4N5O4+ and a molecular weight of 599.01 g/mol. Its IUPAC name is [5-[5-(5-chloro-2-fluorobenzoyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-(2,2-dimethylpropyl)-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [5-[5-(5-chloro-2-fluorobenzoyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-(2,2-dimethylpropyl)-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 173042337 |
| Molecular Formula | C27H29ClF4N5O4+ |
| Molecular Weight | 599.01 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | [5-[5-(5-chloro-2-fluorobenzoyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-(2,2-dimethylpropyl)-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CN1C(=O)[N+](CC(C)(C)C)(OC(=O)C(F)(F)F)c2ccc(N3CC4CCC3CN4C(=O)c3cc(Cl)ccc3F)nc21 |
| InChI | InChI=1S/C27H29ClF4N5O4/c1-26(2,3)14-37(41-24(39)27(30,31)32)20-9-10-21(33-22(20)34(4)25(37)40)35-12-17-7-6-16(35)13-36(17)23(38)18-11-15(28)5-8-19(18)29/h5,8-11,16-17H,6-7,12-14H2,1-4H3/q+1 |
| InChIKey | MCQDSOWPPXEDBS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.01 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|