C27H29N7O10S2 — CID 173043445
5-amino-2-[2-[4-[[4-anilino-6-[bis(2-hydroxyethoxy)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 173043445) has the molecular formula C27H29N7O10S2 and a molecular weight of 675.70 g/mol. Its IUPAC name is 5-amino-2-[2-[4-[[4-anilino-6-[bis(2-hydroxyethoxy)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-amino-2-[2-[4-[[4-anilino-6-[bis(2-hydroxyethoxy)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173043445 |
| Molecular Formula | C27H29N7O10S2 |
| Molecular Weight | 675.70 g/mol |
| Exact Mass | 675.14 |
| IUPAC Name | 5-amino-2-[2-[4-[[4-anilino-6-[bis(2-hydroxyethoxy)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(C=Cc2ccc(Nc3nc(Nc4ccccc4)nc(N(OCCO)OCCO)n3)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C27H29N7O10S2/c28-20-10-8-18(23(16-20)45(37,38)39)6-7-19-9-11-22(17-24(19)46(40,41)42)30-26-31-25(29-21-4-2-1-3-5-21)32-27(33-26)34(43-14-12-35)44-15-13-36/h1-11,16-17,35-36H,12-15,28H2,(H,37,38,39)(H,40,41,42)(H2,29,30,31,32,33) |
| InChIKey | DKQINBRUFLYXLN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 259.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.70 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|