C23H25F3N6O2S — CID 173045497
N-[2-(4-ethylphenyl)ethyl]-N'-[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]methanediamine;2,2,2-trifluoroacetic acid (PubChem CID 173045497) has the molecular formula C23H25F3N6O2S and a molecular weight of 506.55 g/mol. Its IUPAC name is N-[2-(4-ethylphenyl)ethyl]-N'-[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]methanediamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(4-ethylphenyl)ethyl]-N'-[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]methanediamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173045497 |
| Molecular Formula | C23H25F3N6O2S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-[2-(4-ethylphenyl)ethyl]-N'-[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]methanediamine;2,2,2-trifluoroacetic acid |
| SMILES | CCc1ccc(CCNCNc2nnc(-c3ccc4n[nH]c(C)c4c3)s2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H24N6S.C2HF3O2/c1-3-15-4-6-16(7-5-15)10-11-22-13-23-21-27-26-20(28-21)17-8-9-19-18(12-17)14(2)24-25-19;3-2(4,5)1(6)7/h4-9,12,22H,3,10-11,13H2,1-2H3,(H,23,27)(H,24,25);(H,6,7) |
| InChIKey | QZCBWSUZUZUFJG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|