C23H33ClN2 — CID 173045672
1,3-bis(2-tert-butylphenyl)imidazolidine;hydrochloride (PubChem CID 173045672) has the molecular formula C23H33ClN2 and a molecular weight of 372.98 g/mol. Its IUPAC name is 1,3-bis(2-tert-butylphenyl)imidazolidine;hydrochloride.
| Compound Name | 1,3-bis(2-tert-butylphenyl)imidazolidine;hydrochloride |
|---|---|
| PubChem CID | 173045672 |
| Molecular Formula | C23H33ClN2 |
| Molecular Weight | 372.98 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1,3-bis(2-tert-butylphenyl)imidazolidine;hydrochloride |
| SMILES | CC(C)(C)c1ccccc1N1CCN(c2ccccc2C(C)(C)C)C1.Cl |
| InChI | InChI=1S/C23H32N2.ClH/c1-22(2,3)18-11-7-9-13-20(18)24-15-16-25(17-24)21-14-10-8-12-19(21)23(4,5)6;/h7-14H,15-17H2,1-6H3;1H |
| InChIKey | QQQYTIGSBYLEAL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.98 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |