C15H20 — CID 173045974
2-hept-1-yn-3-yl-1,3-dimethylbenzene (PubChem CID 173045974) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-hept-1-yn-3-yl-1,3-dimethylbenzene.
| Compound Name | 2-hept-1-yn-3-yl-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 173045974 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-hept-1-yn-3-yl-1,3-dimethylbenzene |
| SMILES | C#CC(CCCC)c1c(C)cccc1C |
| InChI | InChI=1S/C15H20/c1-5-7-11-14(6-2)15-12(3)9-8-10-13(15)4/h2,8-10,14H,5,7,11H2,1,3-4H3 |
| InChIKey | LJDRTUSVNKLCBW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|