C11H16F2N2O3S — CID 173053548
[(5R)-2-(2,2-difluoroethylimino)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate (PubChem CID 173053548) has the molecular formula C11H16F2N2O3S and a molecular weight of 294.32 g/mol. Its IUPAC name is [(5R)-2-(2,2-difluoroethylimino)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate.
| Compound Name | [(5R)-2-(2,2-difluoroethylimino)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 173053548 |
| Molecular Formula | C11H16F2N2O3S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [(5R)-2-(2,2-difluoroethylimino)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CCC2N/C(=N/CC(F)F)SC2O1 |
| InChI | InChI=1S/C11H16F2N2O3S/c1-6(16)17-5-7-2-3-8-10(18-7)19-11(15-8)14-4-9(12)13/h7-10H,2-5H2,1H3,(H,14,15)/t7-,8?,10?/m1/s1 |
| InChIKey | BRYQMSHROANKGN-ZNFPMYQNSA-N |
| XLogP | 1.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|