C9H15FN2O2S — CID 136506917
(1S)-1-[(3aR,5S,7aR)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]-2-fluoroethanol (PubChem CID 136506917) has the molecular formula C9H15FN2O2S and a molecular weight of 234.30 g/mol. Its IUPAC name is (1S)-1-[(3aR,5S,7aR)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]-2-fluoroethanol.
| Compound Name | (1S)-1-[(3aR,5S,7aR)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]-2-fluoroethanol |
|---|---|
| PubChem CID | 136506917 |
| Molecular Formula | C9H15FN2O2S |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (1S)-1-[(3aR,5S,7aR)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]-2-fluoroethanol |
| SMILES | C/N=C1/N[C@@H]2CC[C@@H]([C@H](O)CF)O[C@@H]2S1 |
| InChI | InChI=1S/C9H15FN2O2S/c1-11-9-12-5-2-3-7(6(13)4-10)14-8(5)15-9/h5-8,13H,2-4H2,1H3,(H,11,12)/t5-,6-,7+,8-/m1/s1 |
| InChIKey | RRTRSLIJYBLGSF-OOJXKGFFSA-N |
| XLogP | 0.51 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|