C9H16N2O2S2 — CID 136596507
(3aR,5R,6S,7aR)-5-[(1S)-1-hydroxyethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazol-6-ol (PubChem CID 136596507) has the molecular formula C9H16N2O2S2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3aR,5R,6S,7aR)-5-[(1S)-1-hydroxyethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazol-6-ol.
| Compound Name | (3aR,5R,6S,7aR)-5-[(1S)-1-hydroxyethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazol-6-ol |
|---|---|
| PubChem CID | 136596507 |
| Molecular Formula | C9H16N2O2S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (3aR,5R,6S,7aR)-5-[(1S)-1-hydroxyethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazol-6-ol |
| SMILES | C/N=C1/N[C@@H]2C[C@H](O)[C@@H]([C@H](C)O)S[C@@H]2S1 |
| InChI | InChI=1S/C9H16N2O2S2/c1-4(12)7-6(13)3-5-8(14-7)15-9(10-2)11-5/h4-8,12-13H,3H2,1-2H3,(H,10,11)/t4-,5+,6-,7+,8+/m0/s1 |
| InChIKey | MWNSLTYIIVHOQL-BZCSJUTBSA-N |
| XLogP | 0.25 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|