C12H21N3O2S — CID 137141078
(3aR,5S,7S,7aR)-5-[(cyclobutylamino)methyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-7-ol (PubChem CID 137141078) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is (3aR,5S,7S,7aR)-5-[(cyclobutylamino)methyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-7-ol.
| Compound Name | (3aR,5S,7S,7aR)-5-[(cyclobutylamino)methyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-7-ol |
|---|---|
| PubChem CID | 137141078 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (3aR,5S,7S,7aR)-5-[(cyclobutylamino)methyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-7-ol |
| SMILES | C/N=C1/N[C@H]2[C@H](O[C@H](CNC3CCC3)C[C@@H]2O)S1 |
| InChI | InChI=1S/C12H21N3O2S/c1-13-12-15-10-9(16)5-8(17-11(10)18-12)6-14-7-3-2-4-7/h7-11,14,16H,2-6H2,1H3,(H,13,15)/t8-,9-,10+,11+/m0/s1 |
| InChIKey | LRQVUPIIDITROV-UKKRHICBSA-N |
| XLogP | 0.30 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|