C15H20N2O5S2 — CID 137127842
5-(benzylsulfonylmethyl)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 137127842) has the molecular formula C15H20N2O5S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-(benzylsulfonylmethyl)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | 5-(benzylsulfonylmethyl)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 137127842 |
| Molecular Formula | C15H20N2O5S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 5-(benzylsulfonylmethyl)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C/N=C1/NC2C(OC(CS(=O)(=O)Cc3ccccc3)C(O)C2O)S1 |
| InChI | InChI=1S/C15H20N2O5S2/c1-16-15-17-11-13(19)12(18)10(22-14(11)23-15)8-24(20,21)7-9-5-3-2-4-6-9/h2-6,10-14,18-19H,7-8H2,1H3,(H,16,17) |
| InChIKey | NAGGFKLUQXFMRF-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|