C19H27N3O4S — CID 136609351
(3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-N-(4-phenylbutyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-5-carboxamide (PubChem CID 136609351) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-N-(4-phenylbutyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-5-carboxamide.
| Compound Name | (3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-N-(4-phenylbutyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 136609351 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-N-(4-phenylbutyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-5-carboxamide |
| SMILES | CC/N=C1/N[C@@H]2[C@@H](O)[C@H](O)[C@@H](C(=O)NCCCCc3ccccc3)O[C@@H]2S1 |
| InChI | InChI=1S/C19H27N3O4S/c1-2-20-19-22-13-14(23)15(24)16(26-18(13)27-19)17(25)21-11-7-6-10-12-8-4-3-5-9-12/h3-5,8-9,13-16,18,23-24H,2,6-7,10-11H2,1H3,(H,20,22)(H,21,25)/t13-,14-,15+,16+,18-/m1/s1 |
| InChIKey | TXLRYILJRVCXAW-KCYAQADSSA-N |
| XLogP | 0.65 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|