C23H27N3O5S — CID 137156142
(3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-N-[2-(4-phenoxyphenyl)ethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-5-carboxamide (PubChem CID 137156142) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-N-[2-(4-phenoxyphenyl)ethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-5-carboxamide.
| Compound Name | (3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-N-[2-(4-phenoxyphenyl)ethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 137156142 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-N-[2-(4-phenoxyphenyl)ethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-5-carboxamide |
| SMILES | CC/N=C1/N[C@@H]2[C@@H](O)[C@H](O)[C@@H](C(=O)NCCc3ccc(Oc4ccccc4)cc3)O[C@@H]2S1 |
| InChI | InChI=1S/C23H27N3O5S/c1-2-24-23-26-17-18(27)19(28)20(31-22(17)32-23)21(29)25-13-12-14-8-10-16(11-9-14)30-15-6-4-3-5-7-15/h3-11,17-20,22,27-28H,2,12-13H2,1H3,(H,24,26)(H,25,29)/t17-,18-,19+,20+,22-/m1/s1 |
| InChIKey | OAVDFFZKCRVLQV-JXDTVZCFSA-N |
| XLogP | 1.67 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|