C19H26N2O4S — CID 147350696
1-[(3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]-5-phenylpentan-1-one (PubChem CID 147350696) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[(3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 147350696 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[(3aR,5S,6S,7R,7aR)-2-ethylimino-6,7-dihydroxy-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]-5-phenylpentan-1-one |
| SMILES | CC/N=C1/N[C@@H]2[C@@H](O)[C@H](O)[C@@H](C(=O)CCCCc3ccccc3)O[C@@H]2S1 |
| InChI | InChI=1S/C19H26N2O4S/c1-2-20-19-21-14-15(23)16(24)17(25-18(14)26-19)13(22)11-7-6-10-12-8-4-3-5-9-12/h3-5,8-9,14-18,23-24H,2,6-7,10-11H2,1H3,(H,20,21)/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | DFIGSHSELWPVTB-UYTYNIKBSA-N |
| XLogP | 1.50 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|