C17H21NO3S — CID 90327499
ethyl 2-(5-phenylpentanoyl)-2,3-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 90327499) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is ethyl 2-(5-phenylpentanoyl)-2,3-dihydro-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(5-phenylpentanoyl)-2,3-dihydro-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 90327499 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | ethyl 2-(5-phenylpentanoyl)-2,3-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)C1=CSC(C(=O)CCCCc2ccccc2)N1 |
| InChI | InChI=1S/C17H21NO3S/c1-2-21-17(20)14-12-22-16(18-14)15(19)11-7-6-10-13-8-4-3-5-9-13/h3-5,8-9,12,16,18H,2,6-7,10-11H2,1H3 |
| InChIKey | DVMQTRFUKONYSO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|