C20H24O4 — CID 70062724
ethyl 6-hydroxy-6-(5-phenylpentanoyl)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 70062724) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is ethyl 6-hydroxy-6-(5-phenylpentanoyl)cyclohexa-2,4-diene-1-carboxylate.
| Compound Name | ethyl 6-hydroxy-6-(5-phenylpentanoyl)cyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 70062724 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | ethyl 6-hydroxy-6-(5-phenylpentanoyl)cyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1C=CC=CC1(O)C(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C20H24O4/c1-2-24-19(22)17-13-8-9-15-20(17,23)18(21)14-7-6-12-16-10-4-3-5-11-16/h3-5,8-11,13,15,17,23H,2,6-7,12,14H2,1H3 |
| InChIKey | NNOCLWMXTWUSFM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|