C17H30N2O4S — CID 136969031
(3aR,5S,6S,7R,7aR)-5-[(1S)-1-(2-cyclohexylethoxy)ethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 136969031) has the molecular formula C17H30N2O4S and a molecular weight of 358.50 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-5-[(1S)-1-(2-cyclohexylethoxy)ethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5S,6S,7R,7aR)-5-[(1S)-1-(2-cyclohexylethoxy)ethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 136969031 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-5-[(1S)-1-(2-cyclohexylethoxy)ethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C/N=C1/N[C@@H]2[C@@H](O)[C@H](O)[C@@H]([C@H](C)OCCC3CCCCC3)O[C@@H]2S1 |
| InChI | InChI=1S/C17H30N2O4S/c1-10(22-9-8-11-6-4-3-5-7-11)15-14(21)13(20)12-16(23-15)24-17(18-2)19-12/h10-16,20-21H,3-9H2,1-2H3,(H,18,19)/t10-,12+,13+,14-,15+,16+/m0/s1 |
| InChIKey | ALHIFSXBTBLGOZ-JOSVURMMSA-N |
| XLogP | 1.50 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|