C8H12F2N2O2S — CID 137104316
5-(difluoromethyl)-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-6-ol (PubChem CID 137104316) has the molecular formula C8H12F2N2O2S and a molecular weight of 238.26 g/mol. Its IUPAC name is 5-(difluoromethyl)-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-6-ol.
| Compound Name | 5-(difluoromethyl)-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-6-ol |
|---|---|
| PubChem CID | 137104316 |
| Molecular Formula | C8H12F2N2O2S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 5-(difluoromethyl)-2-methylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]oxazol-6-ol |
| SMILES | C/N=C1/NC2CC(O)C(C(F)F)SC2O1 |
| InChI | InChI=1S/C8H12F2N2O2S/c1-11-8-12-3-2-4(13)5(6(9)10)15-7(3)14-8/h3-7,13H,2H2,1H3,(H,11,12) |
| InChIKey | JTKJZPKDGCQYNZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|