C40H33F8N3O6 — CID 173057449
N,N-bis[N-(cyclopropylmethoxy)-C-[6-(difluoromethoxy)-2,3-difluorophenyl]carbonimidoyl]-3-oxo-2,4-diphenylbutanamide (PubChem CID 173057449) has the molecular formula C40H33F8N3O6 and a molecular weight of 803.70 g/mol. Its IUPAC name is N,N-bis[N-(cyclopropylmethoxy)-C-[6-(difluoromethoxy)-2,3-difluorophenyl]carbonimidoyl]-3-oxo-2,4-diphenylbutanamide.
| Compound Name | N,N-bis[N-(cyclopropylmethoxy)-C-[6-(difluoromethoxy)-2,3-difluorophenyl]carbonimidoyl]-3-oxo-2,4-diphenylbutanamide |
|---|---|
| PubChem CID | 173057449 |
| Molecular Formula | C40H33F8N3O6 |
| Molecular Weight | 803.70 g/mol |
| Exact Mass | 803.22 |
| IUPAC Name | N,N-bis[N-(cyclopropylmethoxy)-C-[6-(difluoromethoxy)-2,3-difluorophenyl]carbonimidoyl]-3-oxo-2,4-diphenylbutanamide |
| SMILES | O=C(Cc1ccccc1)C(C(=O)N(C(=NOCC1CC1)c1c(OC(F)F)ccc(F)c1F)C(=NOCC1CC1)c1c(OC(F)F)ccc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C40H33F8N3O6/c41-26-15-17-29(56-39(45)46)32(34(26)43)36(49-54-20-23-11-12-23)51(38(53)31(25-9-5-2-6-10-25)28(52)19-22-7-3-1-4-8-22)37(50-55-21-24-13-14-24)33-30(57-40(47)48)18-16-27(42)35(33)44/h1-10,15-18,23-24,31,39-40H,11-14,19-21H2 |
| InChIKey | HQCWYEJKNXTQDK-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 99.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.70 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|