C20H18F4N2O3 — CID 140564708
N-[[4-(cyclopropylmethoxyamino)-6-(difluoromethoxy)-2,3-difluorophenyl]methylidene]-2-phenylacetamide (PubChem CID 140564708) has the molecular formula C20H18F4N2O3 and a molecular weight of 410.37 g/mol. Its IUPAC name is N-[[4-(cyclopropylmethoxyamino)-6-(difluoromethoxy)-2,3-difluorophenyl]methylidene]-2-phenylacetamide.
| Compound Name | N-[[4-(cyclopropylmethoxyamino)-6-(difluoromethoxy)-2,3-difluorophenyl]methylidene]-2-phenylacetamide |
|---|---|
| PubChem CID | 140564708 |
| Molecular Formula | C20H18F4N2O3 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[[4-(cyclopropylmethoxyamino)-6-(difluoromethoxy)-2,3-difluorophenyl]methylidene]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)/N=C/c1c(OC(F)F)cc(NOCC2CC2)c(F)c1F |
| InChI | InChI=1S/C20H18F4N2O3/c21-18-14(10-25-17(27)8-12-4-2-1-3-5-12)16(29-20(23)24)9-15(19(18)22)26-28-11-13-6-7-13/h1-5,9-10,13,20,26H,6-8,11H2/b25-10+ |
| InChIKey | SQMFSUHTJIRXIS-KIBLKLHPSA-N |
| XLogP | 4.51 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|